C31H18N4O2 — CID 134217290
4,5-di(carbazol-9-yl)-2-nitrobenzonitrile (PubChem CID 134217290) has the molecular formula C31H18N4O2 and a molecular weight of 478.51 g/mol. Its IUPAC name is 4,5-di(carbazol-9-yl)-2-nitrobenzonitrile.
| Compound Name | 4,5-di(carbazol-9-yl)-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 134217290 |
| Molecular Formula | C31H18N4O2 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 4,5-di(carbazol-9-yl)-2-nitrobenzonitrile |
| SMILES | N#Cc1cc(-n2c3ccccc3c3ccccc32)c(-n2c3ccccc3c3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H18N4O2/c32-19-20-17-30(33-25-13-5-1-9-21(25)22-10-2-6-14-26(22)33)31(18-29(20)35(36)37)34-27-15-7-3-11-23(27)24-12-4-8-16-28(24)34/h1-18H |
| InChIKey | HSFCXPNGYBJXTA-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|