C28H24F4OPS+ — CID 134222875
[4-(2-fluoroethoxy)phenyl]-diphenyl-[[4-(trifluoromethylsulfanyl)phenyl]methyl]phosphanium (PubChem CID 134222875) has the molecular formula C28H24F4OPS+ and a molecular weight of 515.53 g/mol. Its IUPAC name is [4-(2-fluoroethoxy)phenyl]-diphenyl-[[4-(trifluoromethylsulfanyl)phenyl]methyl]phosphanium.
| Compound Name | [4-(2-fluoroethoxy)phenyl]-diphenyl-[[4-(trifluoromethylsulfanyl)phenyl]methyl]phosphanium |
|---|---|
| PubChem CID | 134222875 |
| Molecular Formula | C28H24F4OPS+ |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | [4-(2-fluoroethoxy)phenyl]-diphenyl-[[4-(trifluoromethylsulfanyl)phenyl]methyl]phosphanium |
| SMILES | FCCOc1ccc([P+](Cc2ccc(SC(F)(F)F)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24F4OPS/c29-19-20-33-23-13-15-26(16-14-23)34(24-7-3-1-4-8-24,25-9-5-2-6-10-25)21-22-11-17-27(18-12-22)35-28(30,31)32/h1-18H,19-21H2/q+1 |
| InChIKey | IIZRTEZBMVFLTC-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|