C11H15NO2 — CID 134223009
(4R)-6-methoxy-N-methyl-3,4-dihydro-1H-isochromen-4-amine (PubChem CID 134223009) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (4R)-6-methoxy-N-methyl-3,4-dihydro-1H-isochromen-4-amine.
| Compound Name | (4R)-6-methoxy-N-methyl-3,4-dihydro-1H-isochromen-4-amine |
|---|---|
| PubChem CID | 134223009 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (4R)-6-methoxy-N-methyl-3,4-dihydro-1H-isochromen-4-amine |
| SMILES | CN[C@H]1COCc2ccc(OC)cc21 |
| InChI | InChI=1S/C11H15NO2/c1-12-11-7-14-6-8-3-4-9(13-2)5-10(8)11/h3-5,11-12H,6-7H2,1-2H3/t11-/m0/s1 |
| InChIKey | PERXYNSPKNGHLP-NSHDSACASA-N |
| XLogP | 1.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |