C11H14O3 — CID 14530781
4,7-dimethoxy-3,4-dihydro-1H-isochromene (PubChem CID 14530781) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4,7-dimethoxy-3,4-dihydro-1H-isochromene.
| Compound Name | 4,7-dimethoxy-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 14530781 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 4,7-dimethoxy-3,4-dihydro-1H-isochromene |
| SMILES | COc1ccc2c(c1)COCC2OC |
| InChI | InChI=1S/C11H14O3/c1-12-9-3-4-10-8(5-9)6-14-7-11(10)13-2/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | ALGBYXADHQRZRZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |