C10H11BrO2 — CID 123524862
7-bromo-4-methoxy-3,4-dihydro-1H-isochromene (PubChem CID 123524862) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is 7-bromo-4-methoxy-3,4-dihydro-1H-isochromene.
| Compound Name | 7-bromo-4-methoxy-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 123524862 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 7-bromo-4-methoxy-3,4-dihydro-1H-isochromene |
| SMILES | COC1COCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H11BrO2/c1-12-10-6-13-5-7-4-8(11)2-3-9(7)10/h2-4,10H,5-6H2,1H3 |
| InChIKey | LIJZSYORKBDVGD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |