About 6-bromo-4-methoxy-4H-1,3-benzodioxine
6-bromo-4-methoxy-4H-1,3-benzodioxine (PubChem CID 167513755) has the molecular formula C9H9BrO3
and a molecular weight of 245.07 g/mol. Its IUPAC name is 6-bromo-4-methoxy-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 6-bromo-4-methoxy-4H-1,3-benzodioxine |
| PubChem CID | 167513755 |
| Molecular Formula | C9H9BrO3 |
| Molecular Weight | 245.07 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | 6-bromo-4-methoxy-4H-1,3-benzodioxine |
| SMILES | COC1OCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C9H9BrO3/c1-11-9-7-4-6(10)2-3-8(7)12-5-13-9/h2-4,9H,5H2,1H3 |
| InChIKey | NYYITQDLPQJRRQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.07 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-4-methoxy-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-methoxy-4H-1,3-benzodioxine?
The IUPAC name of 6-bromo-4-methoxy-4H-1,3-benzodioxine (CID 167513755) is 6-bromo-4-methoxy-4H-1,3-benzodioxine.
What is the SMILES notation for 6-bromo-4-methoxy-4H-1,3-benzodioxine?
The canonical SMILES for 6-bromo-4-methoxy-4H-1,3-benzodioxine is COC1OCOc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-4-methoxy-4H-1,3-benzodioxine?
The InChIKey is NYYITQDLPQJRRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO3/c1-11-9-7-4-6(10)2-3-8(7)12-5-13-9/h2-4,9H,5H2,1H3.
What are the key properties of 6-bromo-4-methoxy-4H-1,3-benzodioxine?
6-bromo-4-methoxy-4H-1,3-benzodioxine has a molecular weight of 245.07 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-methoxy-4H-1,3-benzodioxine is sourced from PubChem (CID 167513755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).