C13H15BrO3 — CID 110143838
(4aS,5R,10aR)-7-bromo-5-methoxy-2,3,4,4a,5,10a-hexahydropyrano[2,3-b]chromene (PubChem CID 110143838) has the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. Its IUPAC name is (4aS,5R,10aR)-7-bromo-5-methoxy-2,3,4,4a,5,10a-hexahydropyrano[2,3-b]chromene.
| Compound Name | (4aS,5R,10aR)-7-bromo-5-methoxy-2,3,4,4a,5,10a-hexahydropyrano[2,3-b]chromene |
|---|---|
| PubChem CID | 110143838 |
| Molecular Formula | C13H15BrO3 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | (4aS,5R,10aR)-7-bromo-5-methoxy-2,3,4,4a,5,10a-hexahydropyrano[2,3-b]chromene |
| SMILES | CO[C@H]1c2cc(Br)ccc2O[C@H]2OCCC[C@H]21 |
| InChI | InChI=1S/C13H15BrO3/c1-15-12-9-3-2-6-16-13(9)17-11-5-4-8(14)7-10(11)12/h4-5,7,9,12-13H,2-3,6H2,1H3/t9-,12+,13+/m0/s1 |
| InChIKey | WYDNXSIQLRVANM-ZWKOPEQDSA-N |
| XLogP | 3.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |