C10H12BrNO — CID 83843334
5-bromo-2-(methylamino)-2,3-dihydro-1H-inden-1-ol (PubChem CID 83843334) has the molecular formula C10H12BrNO and a molecular weight of 242.12 g/mol. Its IUPAC name is 5-bromo-2-(methylamino)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 5-bromo-2-(methylamino)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 83843334 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 5-bromo-2-(methylamino)-2,3-dihydro-1H-inden-1-ol |
| SMILES | CNC1Cc2cc(Br)ccc2C1O |
| InChI | InChI=1S/C10H12BrNO/c1-12-9-5-6-4-7(11)2-3-8(6)10(9)13/h2-4,9-10,12-13H,5H2,1H3 |
| InChIKey | OQHQUKFUFIJLQC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |