About 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide
5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide (PubChem CID 166828796) has the molecular formula C11H12BrNO
and a molecular weight of 254.13 g/mol. Its IUPAC name is 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide |
| PubChem CID | 166828796 |
| Molecular Formula | C11H12BrNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide |
| SMILES | CNC(=O)C1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C11H12BrNO/c1-13-11(14)10-4-2-7-6-8(12)3-5-9(7)10/h3,5-6,10H,2,4H2,1H3,(H,13,14) |
| InChIKey | FMCUVJJFITUSAF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide?
The IUPAC name of 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide (CID 166828796) is 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide.
What is the SMILES notation for 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide?
The canonical SMILES for 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide is CNC(=O)C1CCc2cc(Br)ccc21.
What is the InChIKey of 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide?
The InChIKey is FMCUVJJFITUSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrNO/c1-13-11(14)10-4-2-7-6-8(12)3-5-9(7)10/h3,5-6,10H,2,4H2,1H3,(H,13,14).
What are the key properties of 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide?
5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide has a molecular weight of 254.13 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-methyl-2,3-dihydro-1H-indene-1-carboxamide is sourced from PubChem (CID 166828796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).