C13H13BrO3 — CID 139765880
ethyl 3-(3-bromo-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-oxopropanoate (PubChem CID 139765880) has the molecular formula C13H13BrO3 and a molecular weight of 297.15 g/mol. Its IUPAC name is ethyl 3-(3-bromo-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-oxopropanoate.
| Compound Name | ethyl 3-(3-bromo-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 139765880 |
| Molecular Formula | C13H13BrO3 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | ethyl 3-(3-bromo-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)C1Cc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H13BrO3/c1-2-17-13(16)7-12(15)11-6-8-5-9(14)3-4-10(8)11/h3-5,11H,2,6-7H2,1H3 |
| InChIKey | AGDYVAYGFIIUHQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|