C18H18BrNO3 — CID 71662013
methyl (1R,2R)-5-bromo-1-(4-methoxyanilino)-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 71662013) has the molecular formula C18H18BrNO3 and a molecular weight of 376.25 g/mol. Its IUPAC name is methyl (1R,2R)-5-bromo-1-(4-methoxyanilino)-2,3-dihydro-1H-indene-2-carboxylate.
| Compound Name | methyl (1R,2R)-5-bromo-1-(4-methoxyanilino)-2,3-dihydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 71662013 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | methyl (1R,2R)-5-bromo-1-(4-methoxyanilino)-2,3-dihydro-1H-indene-2-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc(Br)ccc2[C@@H]1Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H18BrNO3/c1-22-14-6-4-13(5-7-14)20-17-15-8-3-12(19)9-11(15)10-16(17)18(21)23-2/h3-9,16-17,20H,10H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | LWKMEVPNGLTWGB-SJORKVTESA-N |
| XLogP | 3.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|