C8H10N4 — CID 134224699
3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile (PubChem CID 134224699) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile.
| Compound Name | 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 134224699 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile |
| SMILES | CCc1n[nH]c2c1CN(C#N)C2 |
| InChI | InChI=1S/C8H10N4/c1-2-7-6-3-12(5-9)4-8(6)11-10-7/h2-4H2,1H3,(H,10,11) |
| InChIKey | VNTSDNWGDSNUEA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|