About 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile
3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile (PubChem CID 134224699) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile |
| PubChem CID | 134224699 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile |
| SMILES | CCc1n[nH]c2c1CN(C#N)C2 |
| InChI | InChI=1S/C8H10N4/c1-2-7-6-3-12(5-9)4-8(6)11-10-7/h2-4H2,1H3,(H,10,11) |
| InChIKey | VNTSDNWGDSNUEA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile?
The IUPAC name of 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile (CID 134224699) is 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile.
What is the SMILES notation for 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile?
The canonical SMILES for 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile is CCc1n[nH]c2c1CN(C#N)C2.
What is the InChIKey of 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile?
The InChIKey is VNTSDNWGDSNUEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-2-7-6-3-12(5-9)4-8(6)11-10-7/h2-4H2,1H3,(H,10,11).
What are the key properties of 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile?
3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile has a molecular weight of 162.20 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile is sourced from PubChem (CID 134224699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).