C16H16N8S — CID 134225061
1-ethylsulfanyl-3-[[2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrimidin-4-yl]amino]azetidine-3-carbonitrile (PubChem CID 134225061) has the molecular formula C16H16N8S and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-ethylsulfanyl-3-[[2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrimidin-4-yl]amino]azetidine-3-carbonitrile.
| Compound Name | 1-ethylsulfanyl-3-[[2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrimidin-4-yl]amino]azetidine-3-carbonitrile |
|---|---|
| PubChem CID | 134225061 |
| Molecular Formula | C16H16N8S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-ethylsulfanyl-3-[[2-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrimidin-4-yl]amino]azetidine-3-carbonitrile |
| SMILES | CCSN1CC(C#N)(Nc2ccnc(-c3ncnc4[nH]ccc34)n2)C1 |
| InChI | InChI=1S/C16H16N8S/c1-2-25-24-8-16(7-17,9-24)23-12-4-6-19-15(22-12)13-11-3-5-18-14(11)21-10-20-13/h3-6,10H,2,8-9H2,1H3,(H,18,20,21)(H,19,22,23) |
| InChIKey | OEQFLMCNWCRJDB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|