C17H17ClN6S — CID 145324867
2-[3-[2-chloro-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrol-1-yl]-1-ethylsulfanylazetidin-3-yl]acetonitrile (PubChem CID 145324867) has the molecular formula C17H17ClN6S and a molecular weight of 372.89 g/mol. Its IUPAC name is 2-[3-[2-chloro-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrol-1-yl]-1-ethylsulfanylazetidin-3-yl]acetonitrile.
| Compound Name | 2-[3-[2-chloro-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrol-1-yl]-1-ethylsulfanylazetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 145324867 |
| Molecular Formula | C17H17ClN6S |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[3-[2-chloro-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrol-1-yl]-1-ethylsulfanylazetidin-3-yl]acetonitrile |
| SMILES | CCSN1CC(CC#N)(n2cc(-c3ncnc4[nH]ccc34)cc2Cl)C1 |
| InChI | InChI=1S/C17H17ClN6S/c1-2-25-23-9-17(10-23,4-5-19)24-8-12(7-14(24)18)15-13-3-6-20-16(13)22-11-21-15/h3,6-8,11H,2,4,9-10H2,1H3,(H,20,21,22) |
| InChIKey | ADMSRZNSFMXMAQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 73.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|