C15H22O3 — CID 134225162
3-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)oxolane-2,5-dione (PubChem CID 134225162) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)oxolane-2,5-dione.
| Compound Name | 3-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 134225162 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 3-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)oxolane-2,5-dione |
| SMILES | CC1CC2CC(C1)CC(C)(C1CC(=O)OC1=O)C2 |
| InChI | InChI=1S/C15H22O3/c1-9-3-10-5-11(4-9)8-15(2,7-10)12-6-13(16)18-14(12)17/h9-12H,3-8H2,1-2H3 |
| InChIKey | PQAMQCJAOWAJND-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|