C7H12N2O3S — CID 134225258
S-[2-(3-formamidopropanoylamino)ethyl] methanethioate (PubChem CID 134225258) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is S-[2-(3-formamidopropanoylamino)ethyl] methanethioate.
| Compound Name | S-[2-(3-formamidopropanoylamino)ethyl] methanethioate |
|---|---|
| PubChem CID | 134225258 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | S-[2-(3-formamidopropanoylamino)ethyl] methanethioate |
| SMILES | O=CNCCC(=O)NCCSC=O |
| InChI | InChI=1S/C7H12N2O3S/c10-5-8-2-1-7(12)9-3-4-13-6-11/h5-6H,1-4H2,(H,8,10)(H,9,12) |
| InChIKey | CHKKGJIFOLQNDL-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|