C23H21F2N5O3 — CID 134227041
3-(1-azidoethyl)-6-[[4-[3-(cyclopropylmethoxy)phenoxy]-2,6-difluorophenyl]methoxy]pyridazine (PubChem CID 134227041) has the molecular formula C23H21F2N5O3 and a molecular weight of 453.45 g/mol. Its IUPAC name is 3-(1-azidoethyl)-6-[[4-[3-(cyclopropylmethoxy)phenoxy]-2,6-difluorophenyl]methoxy]pyridazine.
| Compound Name | 3-(1-azidoethyl)-6-[[4-[3-(cyclopropylmethoxy)phenoxy]-2,6-difluorophenyl]methoxy]pyridazine |
|---|---|
| PubChem CID | 134227041 |
| Molecular Formula | C23H21F2N5O3 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-(1-azidoethyl)-6-[[4-[3-(cyclopropylmethoxy)phenoxy]-2,6-difluorophenyl]methoxy]pyridazine |
| SMILES | CC(N=[N+]=[N-])c1ccc(OCc2c(F)cc(Oc3cccc(OCC4CC4)c3)cc2F)nn1 |
| InChI | InChI=1S/C23H21F2N5O3/c1-14(27-30-26)22-7-8-23(29-28-22)32-13-19-20(24)10-18(11-21(19)25)33-17-4-2-3-16(9-17)31-12-15-5-6-15/h2-4,7-11,14-15H,5-6,12-13H2,1H3 |
| InChIKey | LSIACORIGQWSJV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 102.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|