C32H37NO4 — CID 134227671
(1R,2S,6R,14R,15R,19R)-5-(cyclopropylmethyl)-19-[hydroxy-(3-methylphenyl)methyl]-15-methoxy-19-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol (PubChem CID 134227671) has the molecular formula C32H37NO4 and a molecular weight of 499.65 g/mol. Its IUPAC name is (1R,2S,6R,14R,15R,19R)-5-(cyclopropylmethyl)-19-[hydroxy-(3-methylphenyl)methyl]-15-methoxy-19-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol.
| Compound Name | (1R,2S,6R,14R,15R,19R)-5-(cyclopropylmethyl)-19-[hydroxy-(3-methylphenyl)methyl]-15-methoxy-19-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol |
|---|---|
| PubChem CID | 134227671 |
| Molecular Formula | C32H37NO4 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | (1R,2S,6R,14R,15R,19R)-5-(cyclopropylmethyl)-19-[hydroxy-(3-methylphenyl)methyl]-15-methoxy-19-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol |
| SMILES | CO[C@]12C=C[C@@]3(C[C@]1(C)C(O)c1cccc(C)c1)[C@H]1Cc4ccc(O)c5c4[C@@]3(CCN1CC1CC1)[C@H]2O5 |
| InChI | InChI=1S/C32H37NO4/c1-19-5-4-6-22(15-19)27(35)29(2)18-30-11-12-32(29,36-3)28-31(30)13-14-33(17-20-7-8-20)24(30)16-21-9-10-23(34)26(37-28)25(21)31/h4-6,9-12,15,20,24,27-28,34-35H,7-8,13-14,16-18H2,1-3H3/t24-,27?,28-,29-,30-,31+,32+/m1/s1 |
| InChIKey | CSCPMNWYKRKRHS-WECWCDFJSA-N |
| XLogP | 4.82 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|