About 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole
3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole (PubChem CID 134228404) has the molecular formula C10H4F6N2O
and a molecular weight of 282.14 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| PubChem CID | 134228404 |
| Molecular Formula | C10H4F6N2O |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1cc(-c2ncon2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H4F6N2O/c11-9(12,13)6-1-5(8-17-4-19-18-8)2-7(3-6)10(14,15)16/h1-4H |
| InChIKey | ZASUFORWSGFPOX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole?
The IUPAC name of 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole (CID 134228404) is 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
What is the SMILES notation for 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole?
The canonical SMILES for 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole is FC(F)(F)c1cc(-c2ncon2)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole?
The InChIKey is ZASUFORWSGFPOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4F6N2O/c11-9(12,13)6-1-5(8-17-4-19-18-8)2-7(3-6)10(14,15)16/h1-4H.
What are the key properties of 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole?
3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole has a molecular weight of 282.14 g/mol, XLogP of 3.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole is sourced from PubChem (CID 134228404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).