C10H4F6N2O — CID 134228404
3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole (PubChem CID 134228404) has the molecular formula C10H4F6N2O and a molecular weight of 282.14 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 134228404 |
| Molecular Formula | C10H4F6N2O |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1cc(-c2ncon2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H4F6N2O/c11-9(12,13)6-1-5(8-17-4-19-18-8)2-7(3-6)10(14,15)16/h1-4H |
| InChIKey | ZASUFORWSGFPOX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |