C27H32IN3O5 — CID 134229053
methyl 5-amino-4-[1-iodo-3-oxo-7-[[4-(piperidin-4-ylmethyl)phenyl]methoxy]-1H-isoindol-2-yl]-5-oxopentanoate (PubChem CID 134229053) has the molecular formula C27H32IN3O5 and a molecular weight of 605.47 g/mol. Its IUPAC name is methyl 5-amino-4-[1-iodo-3-oxo-7-[[4-(piperidin-4-ylmethyl)phenyl]methoxy]-1H-isoindol-2-yl]-5-oxopentanoate.
| Compound Name | methyl 5-amino-4-[1-iodo-3-oxo-7-[[4-(piperidin-4-ylmethyl)phenyl]methoxy]-1H-isoindol-2-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 134229053 |
| Molecular Formula | C27H32IN3O5 |
| Molecular Weight | 605.47 g/mol |
| Exact Mass | 605.14 |
| IUPAC Name | methyl 5-amino-4-[1-iodo-3-oxo-7-[[4-(piperidin-4-ylmethyl)phenyl]methoxy]-1H-isoindol-2-yl]-5-oxopentanoate |
| SMILES | COC(=O)CCC(C(N)=O)N1C(=O)c2cccc(OCc3ccc(CC4CCNCC4)cc3)c2C1I |
| InChI | InChI=1S/C27H32IN3O5/c1-35-23(32)10-9-21(26(29)33)31-25(28)24-20(27(31)34)3-2-4-22(24)36-16-19-7-5-17(6-8-19)15-18-11-13-30-14-12-18/h2-8,18,21,25,30H,9-16H2,1H3,(H2,29,33) |
| InChIKey | FZWQBADPJYMMHZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|