C21H24FN3O2 — CID 134229275
tert-butyl (3R)-3-(8-cyano-7-fluoroquinolin-5-yl)-5-methylpiperidine-1-carboxylate (PubChem CID 134229275) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is tert-butyl (3R)-3-(8-cyano-7-fluoroquinolin-5-yl)-5-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(8-cyano-7-fluoroquinolin-5-yl)-5-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 134229275 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | tert-butyl (3R)-3-(8-cyano-7-fluoroquinolin-5-yl)-5-methylpiperidine-1-carboxylate |
| SMILES | CC1C[C@H](c2cc(F)c(C#N)c3ncccc23)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H24FN3O2/c1-13-8-14(12-25(11-13)20(26)27-21(2,3)4)16-9-18(22)17(10-23)19-15(16)6-5-7-24-19/h5-7,9,13-14H,8,11-12H2,1-4H3/t13?,14-/m0/s1 |
| InChIKey | UYOZRPFBVPHQNG-KZUDCZAMSA-N |
| XLogP | 4.61 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |