C17H19NO2 — CID 24766114
tert-butyl 8,9-dihydrobenzo[g]indole-1-carboxylate (PubChem CID 24766114) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl 8,9-dihydrobenzo[g]indole-1-carboxylate.
| Compound Name | tert-butyl 8,9-dihydrobenzo[g]indole-1-carboxylate |
|---|---|
| PubChem CID | 24766114 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | tert-butyl 8,9-dihydrobenzo[g]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc2ccc3c(c21)CCC=C3 |
| InChI | InChI=1S/C17H19NO2/c1-17(2,3)20-16(19)18-11-10-13-9-8-12-6-4-5-7-14(12)15(13)18/h4,6,8-11H,5,7H2,1-3H3 |
| InChIKey | NGBSTSPCBSKDGB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |