C20H38N2O3 — CID 134229653
buta-1,3-diene;2-(diethylamino)butanoyl 2-(diethylamino)butanoate (PubChem CID 134229653) has the molecular formula C20H38N2O3 and a molecular weight of 354.54 g/mol. Its IUPAC name is buta-1,3-diene;2-(diethylamino)butanoyl 2-(diethylamino)butanoate.
| Compound Name | buta-1,3-diene;2-(diethylamino)butanoyl 2-(diethylamino)butanoate |
|---|---|
| PubChem CID | 134229653 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | buta-1,3-diene;2-(diethylamino)butanoyl 2-(diethylamino)butanoate |
| SMILES | C=CC=C.CCC(C(=O)OC(=O)C(CC)N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C16H32N2O3.C4H6/c1-7-13(17(9-3)10-4)15(19)21-16(20)14(8-2)18(11-5)12-6;1-3-4-2/h13-14H,7-12H2,1-6H3;3-4H,1-2H2 |
| InChIKey | MIAMPAZQFOAYDW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|