C9H13NO4 — CID 134229689
(1-formyl-2-oxabicyclo[2.2.2]octan-4-yl)carbamic acid (PubChem CID 134229689) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is (1-formyl-2-oxabicyclo[2.2.2]octan-4-yl)carbamic acid.
| Compound Name | (1-formyl-2-oxabicyclo[2.2.2]octan-4-yl)carbamic acid |
|---|---|
| PubChem CID | 134229689 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (1-formyl-2-oxabicyclo[2.2.2]octan-4-yl)carbamic acid |
| SMILES | O=CC12CCC(NC(=O)O)(CC1)CO2 |
| InChI | InChI=1S/C9H13NO4/c11-5-9-3-1-8(2-4-9,6-14-9)10-7(12)13/h5,10H,1-4,6H2,(H,12,13) |
| InChIKey | RDOICAQXQODERY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|