C12H20N4O6 — CID 87424561
[(1R,2R)-1,2-diacetamido-2-(carboxyamino)cyclohexyl]carbamic acid (PubChem CID 87424561) has the molecular formula C12H20N4O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is [(1R,2R)-1,2-diacetamido-2-(carboxyamino)cyclohexyl]carbamic acid.
| Compound Name | [(1R,2R)-1,2-diacetamido-2-(carboxyamino)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 87424561 |
| Molecular Formula | C12H20N4O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [(1R,2R)-1,2-diacetamido-2-(carboxyamino)cyclohexyl]carbamic acid |
| SMILES | CC(=O)N[C@@]1(NC(=O)O)CCCC[C@@]1(NC(C)=O)NC(=O)O |
| InChI | InChI=1S/C12H20N4O6/c1-7(17)13-11(15-9(19)20)5-3-4-6-12(11,14-8(2)18)16-10(21)22/h15-16H,3-6H2,1-2H3,(H,13,17)(H,14,18)(H,19,20)(H,21,22)/t11-,12-/m1/s1 |
| InChIKey | KQVARHKSSFTPFF-VXGBXAGGSA-N |
| XLogP | -0.24 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|