About (1-chlorocyclohexyl)carbamic acid;hydrochloride
(1-chlorocyclohexyl)carbamic acid;hydrochloride (PubChem CID 70548635) has the molecular formula C7H13Cl2NO2
and a molecular weight of 214.09 g/mol. Its IUPAC name is (1-chlorocyclohexyl)carbamic acid;hydrochloride.
Molecular Properties
| Compound Name | (1-chlorocyclohexyl)carbamic acid;hydrochloride |
| PubChem CID | 70548635 |
| Molecular Formula | C7H13Cl2NO2 |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | (1-chlorocyclohexyl)carbamic acid;hydrochloride |
| SMILES | Cl.O=C(O)NC1(Cl)CCCCC1 |
| InChI | InChI=1S/C7H12ClNO2.ClH/c8-7(9-6(10)11)4-2-1-3-5-7;/h9H,1-5H2,(H,10,11);1H |
| InChIKey | LVRTWMSYDNSYRX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (1-chlorocyclohexyl)carbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-chlorocyclohexyl)carbamic acid;hydrochloride?
The IUPAC name of (1-chlorocyclohexyl)carbamic acid;hydrochloride (CID 70548635) is (1-chlorocyclohexyl)carbamic acid;hydrochloride.
What is the SMILES notation for (1-chlorocyclohexyl)carbamic acid;hydrochloride?
The canonical SMILES for (1-chlorocyclohexyl)carbamic acid;hydrochloride is Cl.O=C(O)NC1(Cl)CCCCC1.
What is the InChIKey of (1-chlorocyclohexyl)carbamic acid;hydrochloride?
The InChIKey is LVRTWMSYDNSYRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNO2.ClH/c8-7(9-6(10)11)4-2-1-3-5-7;/h9H,1-5H2,(H,10,11);1H.
What are the key properties of (1-chlorocyclohexyl)carbamic acid;hydrochloride?
(1-chlorocyclohexyl)carbamic acid;hydrochloride has a molecular weight of 214.09 g/mol, XLogP of 2.58, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-chlorocyclohexyl)carbamic acid;hydrochloride is sourced from PubChem (CID 70548635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).