C9H14Br3NO2 — CID 70525167
[1-(2,2,2-tribromoethyl)cyclohexyl]carbamic acid (PubChem CID 70525167) has the molecular formula C9H14Br3NO2 and a molecular weight of 407.93 g/mol. Its IUPAC name is [1-(2,2,2-tribromoethyl)cyclohexyl]carbamic acid.
| Compound Name | [1-(2,2,2-tribromoethyl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 70525167 |
| Molecular Formula | C9H14Br3NO2 |
| Molecular Weight | 407.93 g/mol |
| Exact Mass | 404.86 |
| IUPAC Name | [1-(2,2,2-tribromoethyl)cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1(CC(Br)(Br)Br)CCCCC1 |
| InChI | InChI=1S/C9H14Br3NO2/c10-9(11,12)6-8(13-7(14)15)4-2-1-3-5-8/h13H,1-6H2,(H,14,15) |
| InChIKey | BYOJTPNYDUBYKX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.93 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|