C11H15BrF3NO2 — CID 104701432
N-[1-(3-bromo-2-oxopropyl)cyclohexyl]-2,2,2-trifluoroacetamide (PubChem CID 104701432) has the molecular formula C11H15BrF3NO2 and a molecular weight of 330.14 g/mol. Its IUPAC name is N-[1-(3-bromo-2-oxopropyl)cyclohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-(3-bromo-2-oxopropyl)cyclohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 104701432 |
| Molecular Formula | C11H15BrF3NO2 |
| Molecular Weight | 330.14 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | N-[1-(3-bromo-2-oxopropyl)cyclohexyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(CBr)CC1(NC(=O)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C11H15BrF3NO2/c12-7-8(17)6-10(4-2-1-3-5-10)16-9(18)11(13,14)15/h1-7H2,(H,16,18) |
| InChIKey | BORRYNNZYJBFNG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.14 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|