About pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate
pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate (PubChem CID 134229849) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate.
Molecular Properties
| Compound Name | pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate |
| PubChem CID | 134229849 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate |
| SMILES | C=CCOCC(=C)C(=O)OC(C)CCC |
| InChI | InChI=1S/C12H20O3/c1-5-7-11(4)15-12(13)10(3)9-14-8-6-2/h6,11H,2-3,5,7-9H2,1,4H3 |
| InChIKey | RVWZCFCODKCXKM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate?
The IUPAC name of pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate (CID 134229849) is pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate.
What is the SMILES notation for pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate?
The canonical SMILES for pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate is C=CCOCC(=C)C(=O)OC(C)CCC.
What is the InChIKey of pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate?
The InChIKey is RVWZCFCODKCXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-5-7-11(4)15-12(13)10(3)9-14-8-6-2/h6,11H,2-3,5,7-9H2,1,4H3.
What are the key properties of pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate?
pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate has a molecular weight of 212.29 g/mol, XLogP of 2.48, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate is sourced from PubChem (CID 134229849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).