About (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone
(6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone (PubChem CID 134231099) has the molecular formula C24H29NO4
and a molecular weight of 395.50 g/mol. Its IUPAC name is (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone |
| PubChem CID | 134231099 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone |
| SMILES | COc1ccc2c(c1)C(C)(C(=O)N1CCC(Oc3ccccc3OC)CC1)CC2 |
| InChI | InChI=1S/C24H29NO4/c1-24(13-10-17-8-9-19(27-2)16-20(17)24)23(26)25-14-11-18(12-15-25)29-22-7-5-4-6-21(22)28-3/h4-9,16,18H,10-15H2,1-3H3 |
| InChIKey | WCEMZRZSMWPNOS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone?
The IUPAC name of (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone (CID 134231099) is (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone.
What is the SMILES notation for (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone?
The canonical SMILES for (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone is COc1ccc2c(c1)C(C)(C(=O)N1CCC(Oc3ccccc3OC)CC1)CC2.
What is the InChIKey of (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone?
The InChIKey is WCEMZRZSMWPNOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO4/c1-24(13-10-17-8-9-19(27-2)16-20(17)24)23(26)25-14-11-18(12-15-25)29-22-7-5-4-6-21(22)28-3/h4-9,16,18H,10-15H2,1-3H3.
What are the key properties of (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone?
(6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone has a molecular weight of 395.50 g/mol, XLogP of 3.98, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxy-1-methyl-2,3-dihydroinden-1-yl)-[4-(2-methoxyphenoxy)piperidin-1-yl]methanone is sourced from PubChem (CID 134231099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).