C17H28O4 — CID 134231832
(2E,5R)-5-[2-(2-butyl-1,3-dioxolan-2-yl)propan-2-yl]-2-(hydroxymethylidene)cyclohexan-1-one (PubChem CID 134231832) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2E,5R)-5-[2-(2-butyl-1,3-dioxolan-2-yl)propan-2-yl]-2-(hydroxymethylidene)cyclohexan-1-one.
| Compound Name | (2E,5R)-5-[2-(2-butyl-1,3-dioxolan-2-yl)propan-2-yl]-2-(hydroxymethylidene)cyclohexan-1-one |
|---|---|
| PubChem CID | 134231832 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (2E,5R)-5-[2-(2-butyl-1,3-dioxolan-2-yl)propan-2-yl]-2-(hydroxymethylidene)cyclohexan-1-one |
| SMILES | CCCCC1(C(C)(C)[C@@H]2CC/C(=C\O)C(=O)C2)OCCO1 |
| InChI | InChI=1S/C17H28O4/c1-4-5-8-17(20-9-10-21-17)16(2,3)14-7-6-13(12-18)15(19)11-14/h12,14,18H,4-11H2,1-3H3/b13-12+/t14-/m1/s1 |
| InChIKey | GVEJUHKHCFSJAA-XTZCOPOCSA-N |
| XLogP | 3.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|