2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid

C12H20O4 — CID 70631028

IUPAC2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid
SMILESCCCCC1(C=C(CC)C(=O)O)OCCO1
InChIInChI=1S/C12H20O4/c1-3-5-6-12(15-7-8-16-12)9-10(4-2)11(13)14/h9H,3-8H2,1-2H3,(H,13,14)
InChIKeyZDXWBXJPRTZWBL-UHFFFAOYSA-N
MW228.29 g/mol
LogP2.34
Rot. Bonds6

About 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid

2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid (PubChem CID 70631028) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid.

Molecular Properties

Compound Name2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid
PubChem CID70631028
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Name2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid
SMILESCCCCC1(C=C(CC)C(=O)O)OCCO1
InChIInChI=1S/C12H20O4/c1-3-5-6-12(15-7-8-16-12)9-10(4-2)11(13)14/h9H,3-8H2,1-2H3,(H,13,14)
InChIKeyZDXWBXJPRTZWBL-UHFFFAOYSA-N
XLogP2.34
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 52.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid?
The IUPAC name of 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid (CID 70631028) is 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid.
What is the SMILES notation for 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid?
The canonical SMILES for 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid is CCCCC1(C=C(CC)C(=O)O)OCCO1.
What is the InChIKey of 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid?
The InChIKey is ZDXWBXJPRTZWBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-3-5-6-12(15-7-8-16-12)9-10(4-2)11(13)14/h9H,3-8H2,1-2H3,(H,13,14).
What are the key properties of 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid?
2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid has a molecular weight of 228.29 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid is sourced from PubChem (CID 70631028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).