C12H20O4 — CID 70631028
2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid (PubChem CID 70631028) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid.
| Compound Name | 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid |
|---|---|
| PubChem CID | 70631028 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-[(2-butyl-1,3-dioxolan-2-yl)methylidene]butanoic acid |
| SMILES | CCCCC1(C=C(CC)C(=O)O)OCCO1 |
| InChI | InChI=1S/C12H20O4/c1-3-5-6-12(15-7-8-16-12)9-10(4-2)11(13)14/h9H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | ZDXWBXJPRTZWBL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|