C12H19ClN2S — CID 134232764
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-ethylhex-5-en-1-amine (PubChem CID 134232764) has the molecular formula C12H19ClN2S and a molecular weight of 258.82 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-ethylhex-5-en-1-amine.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-ethylhex-5-en-1-amine |
|---|---|
| PubChem CID | 134232764 |
| Molecular Formula | C12H19ClN2S |
| Molecular Weight | 258.82 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-ethylhex-5-en-1-amine |
| SMILES | C=CCC(CC)CCNCc1cnc(Cl)s1 |
| InChI | InChI=1S/C12H19ClN2S/c1-3-5-10(4-2)6-7-14-8-11-9-15-12(13)16-11/h3,9-10,14H,1,4-8H2,2H3 |
| InChIKey | XOBNBIPJJWVYGG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|