C10H18O4 — CID 134233370
[(3aR,4S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methanol (PubChem CID 134233370) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is [(3aR,4S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methanol.
| Compound Name | [(3aR,4S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methanol |
|---|---|
| PubChem CID | 134233370 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | [(3aR,4S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methanol |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H]2CC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C10H18O4/c1-10(2)4-6-7(5-11)13-9(12-3)8(6)14-10/h6-9,11H,4-5H2,1-3H3/t6-,7-,8-,9-/m1/s1 |
| InChIKey | CDMULHYAWGZCKV-FNCVBFRFSA-N |
| XLogP | 0.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |