C10H18O5 — CID 138640825
5-(hydroxymethyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6,7-diol (PubChem CID 138640825) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6,7-diol.
| Compound Name | 5-(hydroxymethyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6,7-diol |
|---|---|
| PubChem CID | 138640825 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 5-(hydroxymethyl)-2,2-dimethyl-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6,7-diol |
| SMILES | CC1(C)CC2OC(CO)C(O)C(O)C2O1 |
| InChI | InChI=1S/C10H18O5/c1-10(2)3-5-9(15-10)8(13)7(12)6(4-11)14-5/h5-9,11-13H,3-4H2,1-2H3 |
| InChIKey | BYLCSBMTXDNXDG-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |