C54H30F12N2O2 — CID 134234638
7-[3,6-bis[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3,5-diphenylphenyl)-3-hydroxy-3H-isoindol-1-one (PubChem CID 134234638) has the molecular formula C54H30F12N2O2 and a molecular weight of 966.82 g/mol. Its IUPAC name is 7-[3,6-bis[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3,5-diphenylphenyl)-3-hydroxy-3H-isoindol-1-one.
| Compound Name | 7-[3,6-bis[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3,5-diphenylphenyl)-3-hydroxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 134234638 |
| Molecular Formula | C54H30F12N2O2 |
| Molecular Weight | 966.82 g/mol |
| Exact Mass | 966.21 |
| IUPAC Name | 7-[3,6-bis[3,5-bis(trifluoromethyl)phenyl]carbazol-9-yl]-2-(3,5-diphenylphenyl)-3-hydroxy-3H-isoindol-1-one |
| SMILES | O=C1c2c(cccc2-n2c3ccc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc3c3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)ccc32)C(O)N1c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C54H30F12N2O2/c55-51(56,57)37-19-35(20-38(27-37)52(58,59)60)31-14-16-45-43(25-31)44-26-32(36-21-39(53(61,62)63)28-40(22-36)54(64,65)66)15-17-46(44)68(45)47-13-7-12-42-48(47)50(70)67(49(42)69)41-23-33(29-8-3-1-4-9-29)18-34(24-41)30-10-5-2-6-11-30/h1-28,49,69H |
| InChIKey | FHEGNWDCEMOXMR-UHFFFAOYSA-N |
| XLogP | 16.18 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.82 |
| LogP ≤ 5 | 16.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |