C46H35N3O2S — CID 134237381
2,7-di(carbazol-9-yl)-9,9-dimethyl-10-(4-methylphenyl)sulfonylacridine (PubChem CID 134237381) has the molecular formula C46H35N3O2S and a molecular weight of 693.87 g/mol. Its IUPAC name is 2,7-di(carbazol-9-yl)-9,9-dimethyl-10-(4-methylphenyl)sulfonylacridine.
| Compound Name | 2,7-di(carbazol-9-yl)-9,9-dimethyl-10-(4-methylphenyl)sulfonylacridine |
|---|---|
| PubChem CID | 134237381 |
| Molecular Formula | C46H35N3O2S |
| Molecular Weight | 693.87 g/mol |
| Exact Mass | 693.24 |
| IUPAC Name | 2,7-di(carbazol-9-yl)-9,9-dimethyl-10-(4-methylphenyl)sulfonylacridine |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccc(-n4c5ccccc5c5ccccc54)cc3C(C)(C)c3cc(-n4c5ccccc5c5ccccc54)ccc32)cc1 |
| InChI | InChI=1S/C46H35N3O2S/c1-30-20-24-33(25-21-30)52(50,51)49-44-26-22-31(47-40-16-8-4-12-34(40)35-13-5-9-17-41(35)47)28-38(44)46(2,3)39-29-32(23-27-45(39)49)48-42-18-10-6-14-36(42)37-15-7-11-19-43(37)48/h4-29H,1-3H3 |
| InChIKey | AJXFBDXPBQPXGX-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.87 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |