C23H10F2I6O9S — CID 134237620
2-[3,5-bis[(2,4,6-triiodophenoxy)carbonyl]benzoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 134237620) has the molecular formula C23H10F2I6O9S and a molecular weight of 1261.81 g/mol. Its IUPAC name is 2-[3,5-bis[(2,4,6-triiodophenoxy)carbonyl]benzoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[3,5-bis[(2,4,6-triiodophenoxy)carbonyl]benzoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 134237620 |
| Molecular Formula | C23H10F2I6O9S |
| Molecular Weight | 1261.81 g/mol |
| Exact Mass | 1261.43 |
| IUPAC Name | 2-[3,5-bis[(2,4,6-triiodophenoxy)carbonyl]benzoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)c1cc(C(=O)Oc2c(I)cc(I)cc2I)cc(C(=O)Oc2c(I)cc(I)cc2I)c1 |
| InChI | InChI=1S/C23H10F2I6O9S/c24-23(25,41(35,36)37)8-38-20(32)9-1-10(21(33)39-18-14(28)4-12(26)5-15(18)29)3-11(2-9)22(34)40-19-16(30)6-13(27)7-17(19)31/h1-7H,8H2,(H,35,36,37) |
| InChIKey | MFGZCADSRRVGNH-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1261.81 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|