C11H18N2O — CID 134239209
4-methoxy-2-N-methyl-1-N-propylbenzene-1,2-diamine (PubChem CID 134239209) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-methoxy-2-N-methyl-1-N-propylbenzene-1,2-diamine.
| Compound Name | 4-methoxy-2-N-methyl-1-N-propylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 134239209 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-methoxy-2-N-methyl-1-N-propylbenzene-1,2-diamine |
| SMILES | CCCNc1ccc(OC)cc1NC |
| InChI | InChI=1S/C11H18N2O/c1-4-7-13-10-6-5-9(14-3)8-11(10)12-2/h5-6,8,12-13H,4,7H2,1-3H3 |
| InChIKey | AZJJIGMUYKPYLM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|