C23H21N3O2S — CID 134241829
4-[3-(4-cyclopropylnaphthalen-1-yl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoic acid (PubChem CID 134241829) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is 4-[3-(4-cyclopropylnaphthalen-1-yl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoic acid.
| Compound Name | 4-[3-(4-cyclopropylnaphthalen-1-yl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 134241829 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 4-[3-(4-cyclopropylnaphthalen-1-yl)imidazo[4,5-b]pyridin-2-yl]sulfanylbutanoic acid |
| SMILES | O=C(O)CCCSc1nc2cccnc2n1-c1ccc(C2CC2)c2ccccc12 |
| InChI | InChI=1S/C23H21N3O2S/c27-21(28)8-4-14-29-23-25-19-7-3-13-24-22(19)26(23)20-12-11-16(15-9-10-15)17-5-1-2-6-18(17)20/h1-3,5-7,11-13,15H,4,8-10,14H2,(H,27,28) |
| InChIKey | DIVXCLWOTRTNPW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|