C22H26O4 — CID 134242006
4-(5-ethyl-2-hydroxyphenyl)-6-hex-5-ynyl-2,3-dimethoxyphenol (PubChem CID 134242006) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-(5-ethyl-2-hydroxyphenyl)-6-hex-5-ynyl-2,3-dimethoxyphenol.
| Compound Name | 4-(5-ethyl-2-hydroxyphenyl)-6-hex-5-ynyl-2,3-dimethoxyphenol |
|---|---|
| PubChem CID | 134242006 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-(5-ethyl-2-hydroxyphenyl)-6-hex-5-ynyl-2,3-dimethoxyphenol |
| SMILES | C#CCCCCc1cc(-c2cc(CC)ccc2O)c(OC)c(OC)c1O |
| InChI | InChI=1S/C22H26O4/c1-5-7-8-9-10-16-14-18(21(25-3)22(26-4)20(16)24)17-13-15(6-2)11-12-19(17)23/h1,11-14,23-24H,6-10H2,2-4H3 |
| InChIKey | SUXLAXZOBQMCMZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|