C25H36O8 — CID 126704374
6-(3,4-dimethoxybutyl)-4-[5-(3,3-dimethoxypropyl)-2-hydroxyphenyl]-2,3-dimethoxyphenol (PubChem CID 126704374) has the molecular formula C25H36O8 and a molecular weight of 464.56 g/mol. Its IUPAC name is 6-(3,4-dimethoxybutyl)-4-[5-(3,3-dimethoxypropyl)-2-hydroxyphenyl]-2,3-dimethoxyphenol.
| Compound Name | 6-(3,4-dimethoxybutyl)-4-[5-(3,3-dimethoxypropyl)-2-hydroxyphenyl]-2,3-dimethoxyphenol |
|---|---|
| PubChem CID | 126704374 |
| Molecular Formula | C25H36O8 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 6-(3,4-dimethoxybutyl)-4-[5-(3,3-dimethoxypropyl)-2-hydroxyphenyl]-2,3-dimethoxyphenol |
| SMILES | COCC(CCc1cc(-c2cc(CCC(OC)OC)ccc2O)c(OC)c(OC)c1O)OC |
| InChI | InChI=1S/C25H36O8/c1-28-15-18(29-2)10-9-17-14-20(24(32-5)25(33-6)23(17)27)19-13-16(7-11-21(19)26)8-12-22(30-3)31-4/h7,11,13-14,18,22,26-27H,8-10,12,15H2,1-6H3 |
| InChIKey | INHROMVWIFXMLI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|