C13H18N2O2 — CID 134242649
2-methylpropyl (E)-3-(2-amino-6-methyl-3-pyridinyl)prop-2-enoate (PubChem CID 134242649) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-methylpropyl (E)-3-(2-amino-6-methyl-3-pyridinyl)prop-2-enoate.
| Compound Name | 2-methylpropyl (E)-3-(2-amino-6-methyl-3-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 134242649 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-methylpropyl (E)-3-(2-amino-6-methyl-3-pyridinyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)OCC(C)C)c(N)n1 |
| InChI | InChI=1S/C13H18N2O2/c1-9(2)8-17-12(16)7-6-11-5-4-10(3)15-13(11)14/h4-7,9H,8H2,1-3H3,(H2,14,15)/b7-6+ |
| InChIKey | YMCCRRTYEYHYSV-VOTSOKGWSA-N |
| XLogP | 2.18 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|