C26H37N3O4 — CID 13424443
N-(2-acetylphenyl)-2-[4-[2-hydroxy-3-(1-prop-1-ynylcyclohexyl)oxypropyl]piperazin-1-yl]acetamide (PubChem CID 13424443) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2-[4-[2-hydroxy-3-(1-prop-1-ynylcyclohexyl)oxypropyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-acetylphenyl)-2-[4-[2-hydroxy-3-(1-prop-1-ynylcyclohexyl)oxypropyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 13424443 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | N-(2-acetylphenyl)-2-[4-[2-hydroxy-3-(1-prop-1-ynylcyclohexyl)oxypropyl]piperazin-1-yl]acetamide |
| SMILES | CC#CC1(OCC(O)CN2CCN(CC(=O)Nc3ccccc3C(C)=O)CC2)CCCCC1 |
| InChI | InChI=1S/C26H37N3O4/c1-3-11-26(12-7-4-8-13-26)33-20-22(31)18-28-14-16-29(17-15-28)19-25(32)27-24-10-6-5-9-23(24)21(2)30/h5-6,9-10,22,31H,4,7-8,12-20H2,1-2H3,(H,27,32) |
| InChIKey | AEMWBLUXWWXTBP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|