C26H30FNO — CID 134245609
N-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenyl]prop-2-enamide (PubChem CID 134245609) has the molecular formula C26H30FNO and a molecular weight of 391.53 g/mol. Its IUPAC name is N-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenyl]prop-2-enamide.
| Compound Name | N-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134245609 |
| Molecular Formula | C26H30FNO |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(-c2ccc(C3CCC(CC/C=C/C)CC3)cc2)cc1F |
| InChI | InChI=1S/C26H30FNO/c1-3-5-6-7-19-8-10-20(11-9-19)21-12-14-22(15-13-21)23-16-17-25(24(27)18-23)28-26(29)4-2/h3-5,12-20H,2,6-11H2,1H3,(H,28,29)/b5-3+ |
| InChIKey | WZNVMKNSRKBBEF-HWKANZROSA-N |
| XLogP | 7.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|