C24H14ClF3N2O3 — CID 134247895
6-chloro-3-[(E)-3-pyridin-2-ylprop-2-enoyl]-4-[4-(trifluoromethoxy)phenyl]-1H-quinolin-2-one (PubChem CID 134247895) has the molecular formula C24H14ClF3N2O3 and a molecular weight of 470.83 g/mol. Its IUPAC name is 6-chloro-3-[(E)-3-pyridin-2-ylprop-2-enoyl]-4-[4-(trifluoromethoxy)phenyl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[(E)-3-pyridin-2-ylprop-2-enoyl]-4-[4-(trifluoromethoxy)phenyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 134247895 |
| Molecular Formula | C24H14ClF3N2O3 |
| Molecular Weight | 470.83 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 6-chloro-3-[(E)-3-pyridin-2-ylprop-2-enoyl]-4-[4-(trifluoromethoxy)phenyl]-1H-quinolin-2-one |
| SMILES | O=C(/C=C/c1ccccn1)c1c(-c2ccc(OC(F)(F)F)cc2)c2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C24H14ClF3N2O3/c25-15-6-10-19-18(13-15)21(14-4-8-17(9-5-14)33-24(26,27)28)22(23(32)30-19)20(31)11-7-16-3-1-2-12-29-16/h1-13H,(H,30,32)/b11-7+ |
| InChIKey | FDUCGNIXRJJHRK-YRNVUSSQSA-N |
| XLogP | 6.04 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.83 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|