C21H28N2O — CID 134248703
N-[2-[(1S,3R)-3-(3-methylphenoxy)cyclohexyl]propyl]pyridin-4-amine (PubChem CID 134248703) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is N-[2-[(1S,3R)-3-(3-methylphenoxy)cyclohexyl]propyl]pyridin-4-amine.
| Compound Name | N-[2-[(1S,3R)-3-(3-methylphenoxy)cyclohexyl]propyl]pyridin-4-amine |
|---|---|
| PubChem CID | 134248703 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | N-[2-[(1S,3R)-3-(3-methylphenoxy)cyclohexyl]propyl]pyridin-4-amine |
| SMILES | Cc1cccc(O[C@@H]2CCC[C@H](C(C)CNc3ccncc3)C2)c1 |
| InChI | InChI=1S/C21H28N2O/c1-16-5-3-7-20(13-16)24-21-8-4-6-18(14-21)17(2)15-23-19-9-11-22-12-10-19/h3,5,7,9-13,17-18,21H,4,6,8,14-15H2,1-2H3,(H,22,23)/t17?,18-,21+/m0/s1 |
| InChIKey | ALQYISAGADYTFC-MVDKKGTRSA-N |
| XLogP | 5.08 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |