C23H31NO2 — CID 134259560
2-[[2-[(3R)-3-(3-methylphenoxy)cyclohexyl]propylamino]methyl]phenol (PubChem CID 134259560) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-[[2-[(3R)-3-(3-methylphenoxy)cyclohexyl]propylamino]methyl]phenol.
| Compound Name | 2-[[2-[(3R)-3-(3-methylphenoxy)cyclohexyl]propylamino]methyl]phenol |
|---|---|
| PubChem CID | 134259560 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 2-[[2-[(3R)-3-(3-methylphenoxy)cyclohexyl]propylamino]methyl]phenol |
| SMILES | Cc1cccc(O[C@@H]2CCCC(C(C)CNCc3ccccc3O)C2)c1 |
| InChI | InChI=1S/C23H31NO2/c1-17-7-5-10-21(13-17)26-22-11-6-9-19(14-22)18(2)15-24-16-20-8-3-4-12-23(20)25/h3-5,7-8,10,12-13,18-19,22,24-25H,6,9,11,14-16H2,1-2H3/t18?,19?,22-/m1/s1 |
| InChIKey | HHEWPSDKORREPQ-OBFZPWGMSA-N |
| XLogP | 5.06 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|