C8H12F3NO — CID 134250263
(2Z,4E)-6,6,6-trifluoro-2-methoxy-5-methylhexa-2,4-dien-3-amine (PubChem CID 134250263) has the molecular formula C8H12F3NO and a molecular weight of 195.18 g/mol. Its IUPAC name is (2Z,4E)-6,6,6-trifluoro-2-methoxy-5-methylhexa-2,4-dien-3-amine.
| Compound Name | (2Z,4E)-6,6,6-trifluoro-2-methoxy-5-methylhexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 134250263 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (2Z,4E)-6,6,6-trifluoro-2-methoxy-5-methylhexa-2,4-dien-3-amine |
| SMILES | CO/C(C)=C(N)/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO/c1-5(8(9,10)11)4-7(12)6(2)13-3/h4H,12H2,1-3H3/b5-4+,7-6- |
| InChIKey | WRXIFGHRYYGXAH-DEQVHDEQSA-N |
| XLogP | 2.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|