C8H15NO — CID 163740572
(2Z)-2-methoxy-5-methylhexa-2,4-dien-3-amine (PubChem CID 163740572) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (2Z)-2-methoxy-5-methylhexa-2,4-dien-3-amine.
| Compound Name | (2Z)-2-methoxy-5-methylhexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 163740572 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (2Z)-2-methoxy-5-methylhexa-2,4-dien-3-amine |
| SMILES | CO/C(C)=C(\N)C=C(C)C |
| InChI | InChI=1S/C8H15NO/c1-6(2)5-8(9)7(3)10-4/h5H,9H2,1-4H3/b8-7- |
| InChIKey | LHJIWCFLKAXTTP-FPLPWBNLSA-N |
| XLogP | 1.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|